Public entries in total: 1927
ACPype Server provides you with a set of pre-calculated entries. Each entry includes statitistical information, plots, in addition to the output files generated by this web service.
| Name | Smiles | Views | Downloads | |
|---|---|---|---|---|
| hydrogen-peroxide | OO | |||
| remdesivir | CCC(CC)COC(=O)[C@H](C)N[P@](=O)(OC[C@H]1O[C@](C#N)([C@H](O)[C@@H]1O)C1=CC=C2N1N=CN=C2N)OC1=CC=CC=C1 | |||
| hydrochloric-acid | Cl | |||
| EIDD-1931 | CC(C)C(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N1C=CC(NO)=NC1=O | |||
| fluoroestradiol-F-18 | C[C@]12CC[C@H]3[C@H]([C@@H]1C[C@H]([C@@H]2O)[18F])CCC4=C3C=CC(=C4)O | |||
| ripretinib | CCN1C2=CC(=NC=C2C=C(C1=O)C3=CC(=C(C=C3Br)F)NC(=O)NC4=CC=CC=C4)NC | |||
| selpercatinib | CC(C)(COC1=CN2C(=C(C=N2)C#N)C(=C1)C3=CN=C(C=C3)N4CC5CC(C4)N5CC6=CN=C(C=C6)OC)O | |||
| mefuparib | CNCC1=CC=C(C=C1)C1=CC2=C(O1)C(=CC(F)=C2)C(N)=O | |||
| hydrofluoric-acid | F | |||
| oxygen | O=O | |||
| ammonia | N | |||
| capmatinib | CNC(=O)C1=C(C=C(C=C1)C2=NN3C(=CN=C3N=C2)CC4=CC5=C(C=C4)N=CC=C5)F | |||
| algeldrate | O[Al](O)O | |||
| nitrogen | N#N | |||
| methylhexaneamine | CCC(C)CC(C)N | |||
| chloroform | ClC(Cl)Cl | |||
| ethyl-chloride | CCCl | |||
| formaldehyde | C=O | |||
| diethyl-ether | CCOCC | |||
| iodoform | IC(I)I | |||
| cupric-oxide | O=[Cu] | |||
| dimethyl-sulfoxide | CS(C)=O | |||
| aminocaproic-acid | NCCCCCC(O)=O | |||
| octamoxin | CCCCCCC(C)NN | |||
| mechlorethamine | CN(CCCl)CCCl |
